2-acetoxybenzoic acid


o-acetoxybenzoic acid; 2-acetoxybenzoic acid; 2-(acetyloxy)benzoic acid; 2-acetyloxybenzoic acid; acetylsalicylic acid; O-acetylsalicylic acid; 2-acetylsalicylic acid; aspirin
Links:🌍 Wikipedia, 📏 NIST, 🕷 ChemSpider, 📖 PubMed,
📖Houben-Weyl, 2. Band (Acetylsalicylsäure); p. 441, 518, 540, 574, 653,
MeSH:Analgesics; Anti-Inflammatory Agents, Non-Steroidal; Antipyretics; Enzyme Inhibitors; Fibrin Modulating Agents; Hematologic Agents; Sensory System Agents
CAS RN:[50-78-2]
Formula:C9H8O4; 180.16 g/mol
InChiKey:BSYNRYMUTXBXSQ-UHFFFAOYSA-N
SMILES:CC(=O)Oc1ccccc1C(O)=O
Molecular structure of 2-acetoxybenzoic acid
Toxicology (LD50):3 000 mg/Kg (dog, or); 1 100 mg/Kg(mouse, or); 1 800 mg/Kg(rabbit, or); 700 mg/Kg(rabbit, sc); 500 mg/Kg(rat, ip); 1 360 mg/Kg(rat, or); 1 750 mg/Kg(rat, or)
Density:1.400 g/mL
Molar volume:128.7 mL/mol
Melting point:135 °C
Log10 partition octanol / water:1.19
1g dissolves in:
20.83g water;    400.00g water

Isomers

2-acetoxybenzoic acid
Molecular structure of 2-acetoxybenzoic acid
3-acetoxybenzoic acid
Molecular structure of 3-acetoxybenzoic acid
4-acetoxybenzoic acid
Molecular structure of 4-acetoxybenzoic acid
acetyl benzoyl peroxide
Molecular structure of acetyl benzoyl peroxide
5-acetyl-2-hydroxybenzoic acid
Molecular structure of 5-acetyl-2-hydroxybenzoic acid
1,4-benzodioxan-5-carboxylic acid
Molecular structure of 1,4-benzodioxan-5-carboxylic acid
(R)-1,4-benzodioxane-2-carboxylic acid
Molecular structure of (R)-1,4-benzodioxane-2-carboxylic acid
(S)-1,4-benzodioxane-2-carboxylic acid
Molecular structure of (S)-1,4-benzodioxane-2-carboxylic acid
1,4-benzodioxane-2-carboxylic acid
Molecular structure of 1,4-benzodioxane-2-carboxylic acid
1,4-benzodioxane-6-carboxylic acid
Molecular structure of 1,4-benzodioxane-6-carboxylic acid
benzoyloxyacetic acid
Molecular structure of benzoyloxyacetic acid
caffeic acid
Molecular structure of caffeic acid
4-carboxybenzeneacetic acid
Molecular structure of 4-carboxybenzeneacetic acid
3-(carboxymethyl)benzoic acid
Molecular structure of 3-(carboxymethyl)benzoic acid
2,4-dihydroxycinnamic acid
Molecular structure of 2,4-dihydroxycinnamic acid
2-formylphenoxyacetic acid
Molecular structure of 2-formylphenoxyacetic acid
4-formylphenoxyacetic acid
Molecular structure of 4-formylphenoxyacetic acid
homophthalic acid
Molecular structure of homophthalic acid
3-hydroxy-5-methoxy-2-benzofuran-1(3H)-one
Molecular structure of 3-hydroxy-5-methoxy-2-benzofuran-1(3H)-one
4-hydroxyphenylpyruvic acid
Molecular structure of 4-hydroxyphenylpyruvic acid
6-methoxy-1,3-benzodioxole-5-carbaldehyde
Molecular structure of 6-methoxy-1,3-benzodioxole-5-carbaldehyde
2-methoxycarbonylbenzoic acid
Molecular structure of 2-methoxycarbonylbenzoic acid
3-methoxycarbonylbenzoic acid
Molecular structure of 3-methoxycarbonylbenzoic acid
4-methoxycarbonylbenzoic acid
Molecular structure of 4-methoxycarbonylbenzoic acid
methyl 1,3-benzodioxole-5-carboxylate
Molecular structure of methyl 1,3-benzodioxole-5-carboxylate
3,4-methylendioxyphenylacetic acid
Molecular structure of 3,4-methylendioxyphenylacetic acid
methyl 3-formyl-4-hydroxybenzoate
Molecular structure of methyl 3-formyl-4-hydroxybenzoate
5-methylisophthalic acid
Molecular structure of 5-methylisophthalic acid
4-methylphthalic acid
Molecular structure of 4-methylphthalic acid
4-methyl-3α,4,7,7α-tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione
Molecular structure of 4-methyl-3a,4,7,7a-tetrahydro-4,7-epoxy-2-benzofuran-1,3-dione
2-phenylpropanedioic acid
Molecular structure of 2-phenylpropanedioic acid